C29H43NO6 — CID 87695907
(1S,3S,7S,12S,16R)-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87695907) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is (1S,3S,7S,12S,16R)-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,12S,16R)-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87695907 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | (1S,3S,7S,12S,16R)-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCC1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](C(C)=Cc2ccccn2)C[C@@H]2O[C@]2(C)CCC[C@H](C)C1O |
| InChI | InChI=1S/C29H43NO6/c1-7-21-26(33)18(2)11-10-13-29(6)24(36-29)16-22(19(3)15-20-12-8-9-14-30-20)35-25(32)17-23(31)28(4,5)27(21)34/h8-9,12,14-15,18,21-24,26,31,33H,7,10-11,13,16-17H2,1-6H3/t18-,21?,22-,23-,24-,26?,29+/m0/s1 |
| InChIKey | LXOIBUXTYYNKLI-WZDZOZLBSA-N |
| XLogP | 4.50 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|