C30H43NO6 — CID 87873737
(1S,3S,7S,10R,11S,12S,16R)-10-ethyl-7,11-dihydroxy-12,16-dimethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)spiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione (PubChem CID 87873737) has the molecular formula C30H43NO6 and a molecular weight of 513.68 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-10-ethyl-7,11-dihydroxy-12,16-dimethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)spiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-10-ethyl-7,11-dihydroxy-12,16-dimethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)spiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione |
|---|---|
| PubChem CID | 87873737 |
| Molecular Formula | C30H43NO6 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-10-ethyl-7,11-dihydroxy-12,16-dimethyl-3-(1-pyridin-2-ylprop-1-en-2-yl)spiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione |
| SMILES | CC[C@H]1C(=O)C2(CCC2)[C@@H](O)CC(=O)O[C@H](C(C)=Cc2ccccn2)C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H43NO6/c1-5-22-27(34)19(2)10-8-12-29(4)25(37-29)17-23(20(3)16-21-11-6-7-15-31-21)36-26(33)18-24(32)30(28(22)35)13-9-14-30/h6-7,11,15-16,19,22-25,27,32,34H,5,8-10,12-14,17-18H2,1-4H3/t19-,22+,23-,24-,25-,27-,29+/m0/s1 |
| InChIKey | QOKCCUWVAQMJAV-DNSVYLISSA-N |
| XLogP | 4.64 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|