C29H41NO7 — CID 90967309
(3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 90967309) has the molecular formula C29H41NO7 and a molecular weight of 515.65 g/mol. Its IUPAC name is (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 90967309 |
| Molecular Formula | C29H41NO7 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C[C@H]1CCCC2(C)OC2C[C@@H](C=Cc2ccccn2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](CC2CO2)[C@@H]1O |
| InChI | InChI=1S/C29H41NO7/c1-18-8-7-12-29(4)24(37-29)15-20(11-10-19-9-5-6-13-30-19)36-25(32)16-23(31)28(2,3)27(34)22(26(18)33)14-21-17-35-21/h5-6,9-11,13,18,20-24,26,31,33H,7-8,12,14-17H2,1-4H3/t18-,20+,21?,22+,23-,24?,26+,29?/m0/s1 |
| InChIKey | SSKKOTCGUSWHEK-PXLMKDIOSA-N |
| XLogP | 3.49 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|