C29H41FN2O6 — CID 142652970
3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652970) has the molecular formula C29H41FN2O6 and a molecular weight of 532.65 g/mol. Its IUPAC name is 3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652970 |
| Molecular Formula | C29H41FN2O6 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-(oxiran-2-ylmethyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CCCC2(C)OC2CC(C(F)=Cc2ccccn2)NC(=O)CC(O)C(C)(C)C(=O)C(CC2CO2)C1O |
| InChI | InChI=1S/C29H41FN2O6/c1-17-8-7-10-29(4)24(38-29)14-22(21(30)12-18-9-5-6-11-31-18)32-25(34)15-23(33)28(2,3)27(36)20(26(17)35)13-19-16-37-19/h5-6,9,11-12,17,19-20,22-24,26,33,35H,7-8,10,13-16H2,1-4H3,(H,32,34) |
| InChIKey | AUHZUQRAZMJMEN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|