C29H40FNO6 — CID 151871802
16-(1-fluoro-2-pyridin-2-ylethenyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-7-(oxiran-2-ylmethyl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 151871802) has the molecular formula C29H40FNO6 and a molecular weight of 517.64 g/mol. Its IUPAC name is 16-(1-fluoro-2-pyridin-2-ylethenyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-7-(oxiran-2-ylmethyl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | 16-(1-fluoro-2-pyridin-2-ylethenyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-7-(oxiran-2-ylmethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 151871802 |
| Molecular Formula | C29H40FNO6 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 16-(1-fluoro-2-pyridin-2-ylethenyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-7-(oxiran-2-ylmethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CCC(C(F)=Cc2ccccn2)OC(=O)CC(O)C(C)(C)C(=O)C(CC2CO2)C(O)C(C)CCC1 |
| InChI | InChI=1S/C29H40FNO6/c1-18-8-7-9-19(2)27(34)22(15-21-17-36-21)28(35)29(3,4)25(32)16-26(33)37-24(12-11-18)23(30)14-20-10-5-6-13-31-20/h5-6,10-11,13-14,19,21-22,24-25,27,32,34H,7-9,12,15-17H2,1-4H3 |
| InChIKey | SMVQOQLVIWDHRW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|