C26H35ClFNO5 — CID 10206955
(4S,7R,8S,9S,13E,16S)-13-chloro-16-[(Z)-1-fluoro-2-pyridin-2-ylethenyl]-4,8-dihydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 10206955) has the molecular formula C26H35ClFNO5 and a molecular weight of 496.02 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E,16S)-13-chloro-16-[(Z)-1-fluoro-2-pyridin-2-ylethenyl]-4,8-dihydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E,16S)-13-chloro-16-[(Z)-1-fluoro-2-pyridin-2-ylethenyl]-4,8-dihydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 10206955 |
| Molecular Formula | C26H35ClFNO5 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (4S,7R,8S,9S,13E,16S)-13-chloro-16-[(Z)-1-fluoro-2-pyridin-2-ylethenyl]-4,8-dihydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C[C@H]1CCC/C(Cl)=C\C[C@@H](/C(F)=C/c2ccccn2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C26H35ClFNO5/c1-16-8-7-9-18(27)11-12-21(20(28)14-19-10-5-6-13-29-19)34-23(31)15-22(30)26(3,4)25(33)17(2)24(16)32/h5-6,10-11,13-14,16-17,21-22,24,30,32H,7-9,12,15H2,1-4H3/b18-11+,20-14-/t16-,17+,21-,22-,24-/m0/s1 |
| InChIKey | UZPVWVWIJMORQB-BPNPJANRSA-N |
| XLogP | 4.98 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |