C27H40N2O5 — CID 74956323
6,10-dihydroxy-7,7,9,11,15-pentamethyl-2-(1-pyridin-2-ylprop-1-en-2-yl)-16-oxa-3-azabicyclo[13.1.0]hexadecane-4,8-dione (PubChem CID 74956323) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is 6,10-dihydroxy-7,7,9,11,15-pentamethyl-2-(1-pyridin-2-ylprop-1-en-2-yl)-16-oxa-3-azabicyclo[13.1.0]hexadecane-4,8-dione.
| Compound Name | 6,10-dihydroxy-7,7,9,11,15-pentamethyl-2-(1-pyridin-2-ylprop-1-en-2-yl)-16-oxa-3-azabicyclo[13.1.0]hexadecane-4,8-dione |
|---|---|
| PubChem CID | 74956323 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 6,10-dihydroxy-7,7,9,11,15-pentamethyl-2-(1-pyridin-2-ylprop-1-en-2-yl)-16-oxa-3-azabicyclo[13.1.0]hexadecane-4,8-dione |
| SMILES | CC(=Cc1ccccn1)C1NC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCCC2(C)OC12 |
| InChI | InChI=1S/C27H40N2O5/c1-16-10-9-12-27(6)25(34-27)22(17(2)14-19-11-7-8-13-28-19)29-21(31)15-20(30)26(4,5)24(33)18(3)23(16)32/h7-8,11,13-14,16,18,20,22-23,25,30,32H,9-10,12,15H2,1-6H3,(H,29,31) |
| InChIKey | PPWZNFHNAMTXJE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|