C29H41FN2O5 — CID 142652913
3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652913) has the molecular formula C29H41FN2O5 and a molecular weight of 516.65 g/mol. Its IUPAC name is 3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652913 |
| Molecular Formula | C29H41FN2O5 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 3-(1-fluoro-2-pyridin-2-ylethenyl)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCC1C(=O)C(C)(C)C(O)CC(=O)NC(C(F)=Cc2ccccn2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C29H41FN2O5/c1-6-10-20-26(35)18(2)11-9-13-29(5)24(37-29)16-22(21(30)15-19-12-7-8-14-31-19)32-25(34)17-23(33)28(3,4)27(20)36/h6-8,12,14-15,18,20,22-24,26,33,35H,1,9-11,13,16-17H2,2-5H3,(H,32,34) |
| InChIKey | NSZDKGUNLHDOGF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|