C28H39NO6S — CID 142652899
7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-prop-2-ynyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652899) has the molecular formula C28H39NO6S and a molecular weight of 517.69 g/mol. Its IUPAC name is 7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-prop-2-ynyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-prop-2-ynyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652899 |
| Molecular Formula | C28H39NO6S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-prop-2-ynyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C#CCC1C(=O)C(C)(C)C(O)CC(=O)OC(C=Cc2csc(C)n2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C28H39NO6S/c1-7-9-21-25(32)17(2)10-8-13-28(6)23(35-28)14-20(12-11-19-16-36-18(3)29-19)34-24(31)15-22(30)27(4,5)26(21)33/h1,11-12,16-17,20-23,25,30,32H,8-10,13-15H2,2-6H3 |
| InChIKey | HNVPYDNNYMYLDT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|