C26H40N2O6S — CID 87584498
(1S,3S,7S,10R,11S,12S,16R)-3-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87584498) has the molecular formula C26H40N2O6S and a molecular weight of 508.68 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-3-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-3-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87584498 |
| Molecular Formula | C26H40N2O6S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-3-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C[C@H]1CCC[C@@]2(C)O[C@H]2C[C@@H](C=Cc2csc(CN)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C26H40N2O6S/c1-15-7-6-10-26(5)20(34-26)11-18(9-8-17-14-35-21(13-27)28-17)33-22(30)12-19(29)25(3,4)24(32)16(2)23(15)31/h8-9,14-16,18-20,23,29,31H,6-7,10-13,27H2,1-5H3/t15-,16+,18+,19-,20-,23-,26+/m0/s1 |
| InChIKey | QTRBYHKFIGLFEM-HQVKFOMWSA-N |
| XLogP | 3.24 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|