C29H44N2O5S — CID 91116910
(3S,7S,10R,11R,12S)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91116910) has the molecular formula C29H44N2O5S and a molecular weight of 532.75 g/mol. Its IUPAC name is (3S,7S,10R,11R,12S)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11R,12S)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91116910 |
| Molecular Formula | C29H44N2O5S |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | (3S,7S,10R,11R,12S)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)N[C@H](C=Cc2csc(C)n2)CC2OC2(C)CCC[C@H](C)[C@H]1O |
| InChI | InChI=1S/C29H44N2O5S/c1-7-8-11-22-26(34)18(2)10-9-14-29(6)24(36-29)15-20(12-13-21-17-37-19(3)30-21)31-25(33)16-23(32)28(4,5)27(22)35/h7,12-13,17-18,20,22-24,26,32,34H,1,8-11,14-16H2,2-6H3,(H,31,33)/t18-,20+,22+,23-,24?,26+,29?/m0/s1 |
| InChIKey | XTIIOKCRISVPDA-YXITUUSPSA-N |
| XLogP | 4.61 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|