C29H42ClNO7 — CID 142652967
10-but-3-enyl-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652967) has the molecular formula C29H42ClNO7 and a molecular weight of 552.11 g/mol. Its IUPAC name is 10-but-3-enyl-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 10-but-3-enyl-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652967 |
| Molecular Formula | C29H42ClNO7 |
| Molecular Weight | 552.11 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 10-but-3-enyl-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCCC1C(=O)C(C)(C)C(O)CC(=O)OC(C(Cl)=Cc2coc(C)n2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C29H42ClNO7/c1-7-8-11-20-26(34)17(2)10-9-12-29(6)24(38-29)14-22(21(30)13-19-16-36-18(3)31-19)37-25(33)15-23(32)28(4,5)27(20)35/h7,13,16-17,20,22-24,26,32,34H,1,8-12,14-15H2,2-6H3 |
| InChIKey | JMHGPUBIYZCCFP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|