C31H54N2O3S — CID 142247851
(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;3-methyl-N-[(1Z,3Z)-1-methylsulfanylpenta-1,3-dien-2-yl]butan-1-imine (PubChem CID 142247851) has the molecular formula C31H54N2O3S and a molecular weight of 534.85 g/mol. Its IUPAC name is (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;3-methyl-N-[(1Z,3Z)-1-methylsulfanylpenta-1,3-dien-2-yl]butan-1-imine.
| Compound Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;3-methyl-N-[(1Z,3Z)-1-methylsulfanylpenta-1,3-dien-2-yl]butan-1-imine |
|---|---|
| PubChem CID | 142247851 |
| Molecular Formula | C31H54N2O3S |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;3-methyl-N-[(1Z,3Z)-1-methylsulfanylpenta-1,3-dien-2-yl]butan-1-imine |
| SMILES | C/C=C\C(=C\SC)\N=C\CC(C)C.CC1CCC/C=C\[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H35NO3.C11H19NS/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14;1-5-6-11(9-13-4)12-8-7-10(2)3/h8,10,14-17,22H,6-7,9,11-13H2,1-5H3,(H,21,23);5-6,8-10H,7H2,1-4H3/b10-8-;6-5-,11-9-,12-8+/t14?,15-,16?,17?;/m0./s1 |
| InChIKey | BMCPAFYIGFBWSA-HXCNLVQISA-N |
| XLogP | 7.37 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|