C28H44N2O5S — CID 163530358
(1S,3S,7S,10R,12S,16R)-7-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 163530358) has the molecular formula C28H44N2O5S and a molecular weight of 520.74 g/mol. Its IUPAC name is (1S,3S,7S,10R,12S,16R)-7-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,12S,16R)-7-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 163530358 |
| Molecular Formula | C28H44N2O5S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (1S,3S,7S,10R,12S,16R)-7-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-[2-(methylaminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CNCc1nc(/C=C(\C)[C@@H]2C[C@@H]3O[C@]3(C)CCC[C@H](C)C[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C28H44N2O5S/c1-17-9-8-10-28(6)23(35-28)13-21(18(2)12-20-16-36-24(30-20)15-29-7)34-25(32)14-22(31)27(4,5)26(33)19(3)11-17/h12,16-17,19,21-23,29,31H,8-11,13-15H2,1-7H3/b18-12+/t17-,19+,21-,22-,23-,28+/m0/s1 |
| InChIKey | DSLUBUVRTFDTDR-FMVSPXIZSA-N |
| XLogP | 4.92 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|