C20H34O5 — CID 142802654
(11E)-4,14-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-11-ene-2,6-dione (PubChem CID 142802654) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (11E)-4,14-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-11-ene-2,6-dione.
| Compound Name | (11E)-4,14-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-11-ene-2,6-dione |
|---|---|
| PubChem CID | 142802654 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (11E)-4,14-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-11-ene-2,6-dione |
| SMILES | CC1C/C=C/C(C)C(O)CCOC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H34O5/c1-13-7-6-8-14(2)16(21)9-10-25-18(23)12-17(22)20(4,5)19(24)15(3)11-13/h6,8,13-17,21-22H,7,9-12H2,1-5H3/b8-6+ |
| InChIKey | YZWWPNBBDBFPES-SOFGYWHQSA-N |
| XLogP | 2.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|