C22H34O6 — CID 140533283
(4S,7R,8S,9S,10Z,13Z,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 140533283) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (4S,7R,8S,9S,10Z,13Z,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10Z,13Z,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 140533283 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (4S,7R,8S,9S,10Z,13Z,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC(=O)[C@@H]1C/C=C(/C)C/C=C\[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C22H34O6/c1-13-8-7-9-14(2)20(26)15(3)21(27)22(5,6)18(24)12-19(25)28-17(11-10-13)16(4)23/h7,9-10,14-15,17-18,20,24,26H,8,11-12H2,1-6H3/b9-7-,13-10-/t14-,15+,17-,18-,20-/m0/s1 |
| InChIKey | UYFSBJIOUFGIGV-IWPAGBKCSA-N |
| XLogP | 2.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|