C27H36N2O5S2 — CID 11519409
(4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 11519409) has the molecular formula C27H36N2O5S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is (4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 11519409 |
| Molecular Formula | C27H36N2O5S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](c2csc(-c3csc(C)n3)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)/C=C\C1 |
| InChI | InChI=1S/C27H36N2O5S2/c1-15-8-7-9-16(2)24(32)17(3)25(33)27(5,6)22(30)12-23(31)34-21(11-10-15)19-13-36-26(29-19)20-14-35-18(4)28-20/h7,9-10,13-14,16-17,21-22,24,30,32H,8,11-12H2,1-6H3/b9-7-,15-10-/t16-,17+,21-,22-,24-/m0/s1 |
| InChIKey | UEJCKGXANKGBFZ-XHIKHYPXSA-N |
| XLogP | 5.44 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|