C24H38INO5S — CID 163693149
(4S,7R,9S,13Z,16R)-4,6,8-trihydroxy-16-iodo-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadec-13-en-2-one (PubChem CID 163693149) has the molecular formula C24H38INO5S and a molecular weight of 579.54 g/mol. Its IUPAC name is (4S,7R,9S,13Z,16R)-4,6,8-trihydroxy-16-iodo-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadec-13-en-2-one.
| Compound Name | (4S,7R,9S,13Z,16R)-4,6,8-trihydroxy-16-iodo-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadec-13-en-2-one |
|---|---|
| PubChem CID | 163693149 |
| Molecular Formula | C24H38INO5S |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | (4S,7R,9S,13Z,16R)-4,6,8-trihydroxy-16-iodo-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadec-13-en-2-one |
| SMILES | C/C1=C/C[C@@](I)(c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(O)[C@H](C)C(O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C24H38INO5S/c1-14-8-7-9-15(2)21(29)16(3)22(30)23(5,6)19(27)12-20(28)31-24(25,11-10-14)18-13-32-17(4)26-18/h10,13,15-16,19,21-22,27,29-30H,7-9,11-12H2,1-6H3/b14-10-/t15-,16+,19-,21?,22?,24-/m0/s1 |
| InChIKey | JURKXIPCBMXSQR-GHQMOOAKSA-N |
| XLogP | 4.87 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|