C26H41NO6S — CID 163588315
(4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(1R)-1-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 163588315) has the molecular formula C26H41NO6S and a molecular weight of 495.68 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(1R)-1-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(1R)-1-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 163588315 |
| Molecular Formula | C26H41NO6S |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(1R)-1-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | Cc1nc([C@H](O)C(C)[C@@H]2C/C=C\CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C26H41NO6S/c1-15-11-9-7-8-10-12-20(16(2)24(31)19-14-34-18(4)27-19)33-22(29)13-21(28)26(5,6)25(32)17(3)23(15)30/h8,10,14-17,20-21,23-24,28,30-31H,7,9,11-13H2,1-6H3/b10-8-/t15-,16?,17+,20-,21-,23-,24+/m0/s1 |
| InChIKey | GNJNQSFXYCWQNN-AUUQDSSBSA-N |
| XLogP | 4.14 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|