C27H39NO7 — CID 70803679
(4S,7R,8S,9S,10E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-(2-methoxy-1,3-oxazol-4-yl)prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 70803679) has the molecular formula C27H39NO7 and a molecular weight of 489.61 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-(2-methoxy-1,3-oxazol-4-yl)prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-(2-methoxy-1,3-oxazol-4-yl)prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 70803679 |
| Molecular Formula | C27H39NO7 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | (4S,7R,8S,9S,10E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-(2-methoxy-1,3-oxazol-4-yl)prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | COc1nc(/C=C(\C)[C@@H]2C/C=C(/C)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)co1 |
| InChI | InChI=1S/C27H39NO7/c1-16-9-8-10-17(2)24(31)19(4)25(32)27(5,6)22(29)14-23(30)35-21(12-11-16)18(3)13-20-15-34-26(28-20)33-7/h8,10-11,13,15,17,19,21-22,24,29,31H,9,12,14H2,1-7H3/b10-8+,16-11-,18-13+/t17-,19+,21-,22-,24-/m0/s1 |
| InChIKey | ASJBPWGJUADWTJ-WXZUXNQTSA-N |
| XLogP | 4.27 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|