C28H41NO7 — CID 11511727
(3Z,6R,10S,13R,14S,15S)-10,14-dihydroxy-6-[(E)-1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione (PubChem CID 11511727) has the molecular formula C28H41NO7 and a molecular weight of 503.64 g/mol. Its IUPAC name is (3Z,6R,10S,13R,14S,15S)-10,14-dihydroxy-6-[(E)-1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione.
| Compound Name | (3Z,6R,10S,13R,14S,15S)-10,14-dihydroxy-6-[(E)-1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione |
|---|---|
| PubChem CID | 11511727 |
| Molecular Formula | C28H41NO7 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | (3Z,6R,10S,13R,14S,15S)-10,14-dihydroxy-6-[(E)-1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione |
| SMILES | C/C1=C/C[C@H](/C(C)=C/c2coc(CO)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@@H](C)[C@@H](O)[C@@H](C)C2CC2C1 |
| InChI | InChI=1S/C28H41NO7/c1-15-7-8-22(16(2)10-20-14-35-24(13-30)29-20)36-25(32)12-23(31)28(5,6)27(34)18(4)26(33)17(3)21-11-19(21)9-15/h7,10,14,17-19,21-23,26,30-31,33H,8-9,11-13H2,1-6H3/b15-7-,16-10+/t17-,18-,19?,21?,22+,23-,26-/m0/s1 |
| InChIKey | WGIDFLHYQWATQW-JAMVWAQUSA-N |
| XLogP | 3.84 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|