C30H49NO6 — CID 143101017
(3Z,6S,10S,13R,14S,15S)-6-[(2E,4Z)-4-amino-5-butan-2-yloxypenta-2,4-dien-2-yl]-10,14-dihydroxy-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione (PubChem CID 143101017) has the molecular formula C30H49NO6 and a molecular weight of 519.72 g/mol. Its IUPAC name is (3Z,6S,10S,13R,14S,15S)-6-[(2E,4Z)-4-amino-5-butan-2-yloxypenta-2,4-dien-2-yl]-10,14-dihydroxy-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione.
| Compound Name | (3Z,6S,10S,13R,14S,15S)-6-[(2E,4Z)-4-amino-5-butan-2-yloxypenta-2,4-dien-2-yl]-10,14-dihydroxy-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione |
|---|---|
| PubChem CID | 143101017 |
| Molecular Formula | C30H49NO6 |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | (3Z,6S,10S,13R,14S,15S)-6-[(2E,4Z)-4-amino-5-butan-2-yloxypenta-2,4-dien-2-yl]-10,14-dihydroxy-3,11,11,13,15-pentamethyl-7-oxabicyclo[14.1.0]heptadec-3-ene-8,12-dione |
| SMILES | CCC(C)O/C=C(N)/C=C(\C)[C@@H]1C/C=C(/C)CC2CC2[C@H](C)[C@H](O)[C@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C30H49NO6/c1-9-19(4)36-16-23(31)13-18(3)25-11-10-17(2)12-22-14-24(22)20(5)28(34)21(6)29(35)30(7,8)26(32)15-27(33)37-25/h10,13,16,19-22,24-26,28,32,34H,9,11-12,14-15,31H2,1-8H3/b17-10-,18-13+,23-16-/t19?,20-,21-,22?,24?,25-,26-,28-/m0/s1 |
| InChIKey | ADDLIFSTYKUCDN-FCQCDIGISA-N |
| XLogP | 4.82 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|