C28H42N2O6S — CID 135756223
(7S,11R,14R,15S,16S)-7-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11,15-dihydroxy-3,12,12,14,16-pentamethyl-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione (PubChem CID 135756223) has the molecular formula C28H42N2O6S and a molecular weight of 534.72 g/mol. Its IUPAC name is (7S,11R,14R,15S,16S)-7-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11,15-dihydroxy-3,12,12,14,16-pentamethyl-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione.
| Compound Name | (7S,11R,14R,15S,16S)-7-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11,15-dihydroxy-3,12,12,14,16-pentamethyl-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione |
|---|---|
| PubChem CID | 135756223 |
| Molecular Formula | C28H42N2O6S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | (7S,11R,14R,15S,16S)-7-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11,15-dihydroxy-3,12,12,14,16-pentamethyl-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione |
| SMILES | C/C(=C\c1csc(CN)n1)[C@@H]1CC2OC2(C)CC2CC2[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C28H42N2O6S/c1-14(7-18-13-37-23(12-29)30-18)20-9-22-28(6,36-22)11-17-8-19(17)15(2)25(33)16(3)26(34)27(4,5)21(31)10-24(32)35-20/h7,13,15-17,19-22,25,31,33H,8-12,29H2,1-6H3/b14-7+/t15-,16+,17?,19?,20-,21+,22?,25-,28?/m0/s1 |
| InChIKey | SXXZVEQZIXZNKB-SVIBXZBFSA-N |
| XLogP | 3.48 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|