C28H42N2O5S — CID 59732606
(3S,7S,10R,11S,12S,13E)-3-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione (PubChem CID 59732606) has the molecular formula C28H42N2O5S and a molecular weight of 518.72 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S,13E)-3-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S,13E)-3-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
|---|---|
| PubChem CID | 59732606 |
| Molecular Formula | C28H42N2O5S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | (3S,7S,10R,11S,12S,13E)-3-[(E)-1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
| SMILES | C/C(=C\c1csc(CN)n1)[C@@H]1CC2CC2(C)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C28H42N2O5S/c1-16-8-7-9-28(6)13-19(28)11-21(17(2)10-20-15-36-23(14-29)30-20)35-24(32)12-22(31)27(4,5)26(34)18(3)25(16)33/h7-8,10,15-16,18-19,21-22,25,31,33H,9,11-14,29H2,1-6H3/b8-7+,17-10+/t16-,18+,19?,21-,22-,25-,28?/m0/s1 |
| InChIKey | RXVLINBBDWGGQR-KVURHTJXSA-N |
| XLogP | 4.27 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|