C27H39NO8 — CID 91081026
(3S,7S,10R,11S,12S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione (PubChem CID 91081026) has the molecular formula C27H39NO8 and a molecular weight of 505.61 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
|---|---|
| PubChem CID | 91081026 |
| Molecular Formula | C27H39NO8 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (3S,7S,10R,11S,12S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-oxazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
| SMILES | CC(=Cc1coc(CO)n1)[C@@H]1CC2OC2(C)CC=C[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H39NO8/c1-15-8-7-9-27(6)21(36-27)11-19(16(2)10-18-14-34-22(13-29)28-18)35-23(31)12-20(30)26(4,5)25(33)17(3)24(15)32/h7-8,10,14-15,17,19-21,24,29-30,32H,9,11-13H2,1-6H3/t15-,17+,19-,20-,21?,24-,27?/m0/s1 |
| InChIKey | BVBVUKDTVZXCAG-LBFBGEQGSA-N |
| XLogP | 2.97 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|