C27H37F3N2O5S — CID 91001253
(4S,7R,8S,9S,16S)-16-[1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 91001253) has the molecular formula C27H37F3N2O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-16-[1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-16-[1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 91001253 |
| Molecular Formula | C27H37F3N2O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | (4S,7R,8S,9S,16S)-16-[1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC(=Cc1csc(CN)n1)[C@@H]1CC=C(C(F)(F)F)CC=C[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H37F3N2O5S/c1-15-7-6-8-18(27(28,29)30)9-10-20(16(2)11-19-14-38-22(13-31)32-19)37-23(34)12-21(33)26(4,5)25(36)17(3)24(15)35/h6-7,9,11,14-15,17,20-21,24,33,35H,8,10,12-13,31H2,1-5H3/t15-,17+,20-,21-,24-/m0/s1 |
| InChIKey | AFQMJRINDQDTSU-BJDSTGPJSA-N |
| XLogP | 4.74 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|