C29H50O5Si — CID 71105779
(4S,7R,8S,9S,10E,13Z)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9,13-hexamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 71105779) has the molecular formula C29H50O5Si and a molecular weight of 506.80 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13Z)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9,13-hexamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13Z)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9,13-hexamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 71105779 |
| Molecular Formula | C29H50O5Si |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (4S,7R,8S,9S,10E,13Z)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9,13-hexamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC(=O)C1C/C=C(/C)C/C=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)O1 |
| InChI | InChI=1S/C29H50O5Si/c1-19-14-13-15-20(2)26(34-35(11,12)28(6,7)8)22(4)27(32)29(9,10)21(3)18-25(31)33-24(17-16-19)23(5)30/h13,15-16,20-22,24,26H,14,17-18H2,1-12H3/b15-13+,19-16-/t20-,21-,22+,24?,26-/m0/s1 |
| InChIKey | FCFZINFNGXTIDG-YRQQQONISA-N |
| XLogP | 7.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|