C33H50N2O6S — CID 123887099
[(4S,7R,8S,9S,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-oxacyclohexadeca-10,13-dien-4-yl] 6-aminohexanoate (PubChem CID 123887099) has the molecular formula C33H50N2O6S and a molecular weight of 602.84 g/mol. Its IUPAC name is [(4S,7R,8S,9S,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-oxacyclohexadeca-10,13-dien-4-yl] 6-aminohexanoate.
| Compound Name | [(4S,7R,8S,9S,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-oxacyclohexadeca-10,13-dien-4-yl] 6-aminohexanoate |
|---|---|
| PubChem CID | 123887099 |
| Molecular Formula | C33H50N2O6S |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | [(4S,7R,8S,9S,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-oxacyclohexadeca-10,13-dien-4-yl] 6-aminohexanoate |
| SMILES | CC1=CC[C@@H](C(C)=Cc2csc(C)n2)OC(=O)C[C@H](OC(=O)CCCCCN)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)C=CC1 |
| InChI | InChI=1S/C33H50N2O6S/c1-21-12-11-13-22(2)31(38)24(4)32(39)33(6,7)28(41-29(36)14-9-8-10-17-34)19-30(37)40-27(16-15-21)23(3)18-26-20-42-25(5)35-26/h11,13,15,18,20,22,24,27-28,31,38H,8-10,12,14,16-17,19,34H2,1-7H3/t22-,24+,27-,28-,31-/m0/s1 |
| InChIKey | IQYIHLQCLXXNDB-DFYLJQCOSA-N |
| XLogP | 6.11 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|