C33H62O6Si2 — CID 10121687
(4S,7R,8S,9R,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 10121687) has the molecular formula C33H62O6Si2 and a molecular weight of 611.03 g/mol. Its IUPAC name is (4S,7R,8S,9R,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9R,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 10121687 |
| Molecular Formula | C33H62O6Si2 |
| Molecular Weight | 611.03 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | (4S,7R,8S,9R,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC(=O)[C@@H]1C/C=C\CCC[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C33H62O6Si2/c1-23-20-18-16-17-19-21-26(25(3)34)37-28(35)22-27(38-40(12,13)31(4,5)6)33(10,11)30(36)24(2)29(23)39-41(14,15)32(7,8)9/h17,19,23-24,26-27,29H,16,18,20-22H2,1-15H3/b19-17-/t23-,24-,26+,27+,29+/m1/s1 |
| InChIKey | NUPNDTWPNCURJQ-SLRLFWHTSA-N |
| XLogP | 8.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.03 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|