C25H42O6 — CID 22966984
3-[(E)-but-2-en-2-yl]-7,11-dimethoxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 22966984) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3-[(E)-but-2-en-2-yl]-7,11-dimethoxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[(E)-but-2-en-2-yl]-7,11-dimethoxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 22966984 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 3-[(E)-but-2-en-2-yl]-7,11-dimethoxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C=C(\C)C1CC2OC2CCCC(C)C(OC)C(C)C(=O)C(C)(C)C(OC)CC(=O)O1 |
| InChI | InChI=1S/C25H42O6/c1-9-15(2)19-13-20-18(30-20)12-10-11-16(3)23(29-8)17(4)24(27)25(5,6)21(28-7)14-22(26)31-19/h9,16-21,23H,10-14H2,1-8H3/b15-9+ |
| InChIKey | RAAGSRRSUARKEF-OQLLNIDSSA-N |
| XLogP | 4.49 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|