C28H41NO6 — CID 177386697
(1S,3S,7S,10R,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 177386697) has the molecular formula C28H41NO6 and a molecular weight of 487.64 g/mol. Its IUPAC name is (1S,3S,7S,10R,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 177386697 |
| Molecular Formula | C28H41NO6 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | (1S,3S,7S,10R,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1ccc(C)cn1)[C@@H]1C[C@@H]2O[C@@H]2CCC[C@H](C)C(O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C28H41NO6/c1-16-10-11-20(29-15-16)12-18(3)22-13-23-21(34-23)9-7-8-17(2)26(32)19(4)27(33)28(5,6)24(30)14-25(31)35-22/h10-12,15,17,19,21-24,26,30,32H,7-9,13-14H2,1-6H3/b18-12+/t17-,19+,21+,22-,23-,24-,26?/m0/s1 |
| InChIKey | JJWRYFBFOOIWQL-OPDSLIHTSA-N |
| XLogP | 4.03 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|