C29H43NO5 — CID 91103234
(1S,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91103234) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91103234 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(5-methyl-2-pyridinyl)prop-1-en-2-yl]-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=Cc1ccc(C)cn1)[C@@H]1C[C@@H]2C[C@@H]2CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C29H43NO5/c1-17-10-11-23(30-16-17)12-19(3)24-14-22-13-21(22)9-7-8-18(2)27(33)20(4)28(34)29(5,6)25(31)15-26(32)35-24/h10-12,16,18,20-22,24-25,27,31,33H,7-9,13-15H2,1-6H3/t18-,20+,21-,22-,24-,25-,27-/m0/s1 |
| InChIKey | MHRYIUJPPVFCBJ-IVMALFHGSA-N |
| XLogP | 4.89 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |