C27H38INO6S — CID 90844417
(1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-3-[1-[2-(2-iodoethenyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 90844417) has the molecular formula C27H38INO6S and a molecular weight of 631.57 g/mol. Its IUPAC name is (1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-3-[1-[2-(2-iodoethenyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-3-[1-[2-(2-iodoethenyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 90844417 |
| Molecular Formula | C27H38INO6S |
| Molecular Weight | 631.57 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | (1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-3-[1-[2-(2-iodoethenyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=Cc1csc(C=CI)n1)[C@H]1C[C@@H]2O[C@H]2CCC[C@@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H38INO6S/c1-15-7-6-8-19-21(34-19)12-20(16(2)11-18-14-36-23(29-18)9-10-28)35-24(31)13-22(30)27(4,5)26(33)17(3)25(15)32/h9-11,14-15,17,19-22,25,30,32H,6-8,12-13H2,1-5H3/t15-,17+,19+,20-,21+,22-,25-/m1/s1 |
| InChIKey | UKILQVQHTPHZIK-SRIXIFFZSA-N |
| XLogP | 5.18 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|