C26H38N4O6S — CID 91231548
(1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91231548) has the molecular formula C26H38N4O6S and a molecular weight of 534.68 g/mol. Its IUPAC name is (1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91231548 |
| Molecular Formula | C26H38N4O6S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | (1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=Cc1csc(CN=[N+]=[N-])n1)[C@H]1C[C@@H]2O[C@H]2CCC[C@@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H38N4O6S/c1-14-7-6-8-18-20(35-18)10-19(15(2)9-17-13-37-22(29-17)12-28-30-27)36-23(32)11-21(31)26(4,5)25(34)16(3)24(14)33/h9,13-14,16,18-21,24,31,33H,6-8,10-12H2,1-5H3/t14-,16+,18+,19-,20+,21-,24-/m1/s1 |
| InChIKey | KDQCCSFTJMIVLV-WKUXKFHZSA-N |
| XLogP | 4.59 |
| TPSA | 158.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|