C25H43N3O7P2 — CID 59968711
[(11R)-4-azido-2-[(E)-but-2-en-2-yl]-9,11,13,13-tetramethyl-12,16-dioxo-10,14-bis(phosphanyloxy)-oxacyclohexadec-5-yl] acetate (PubChem CID 59968711) has the molecular formula C25H43N3O7P2 and a molecular weight of 559.58 g/mol. Its IUPAC name is [(11R)-4-azido-2-[(E)-but-2-en-2-yl]-9,11,13,13-tetramethyl-12,16-dioxo-10,14-bis(phosphanyloxy)-oxacyclohexadec-5-yl] acetate.
| Compound Name | [(11R)-4-azido-2-[(E)-but-2-en-2-yl]-9,11,13,13-tetramethyl-12,16-dioxo-10,14-bis(phosphanyloxy)-oxacyclohexadec-5-yl] acetate |
|---|---|
| PubChem CID | 59968711 |
| Molecular Formula | C25H43N3O7P2 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | [(11R)-4-azido-2-[(E)-but-2-en-2-yl]-9,11,13,13-tetramethyl-12,16-dioxo-10,14-bis(phosphanyloxy)-oxacyclohexadec-5-yl] acetate |
| SMILES | C/C=C(\C)C1CC(N=[N+]=[N-])C(OC(C)=O)CCCC(C)C(OP)[C@@H](C)C(=O)C(C)(C)C(OP)CC(=O)O1 |
| InChI | InChI=1S/C25H43N3O7P2/c1-8-14(2)20-12-18(27-28-26)19(32-17(5)29)11-9-10-15(3)23(35-37)16(4)24(31)25(6,7)21(34-36)13-22(30)33-20/h8,15-16,18-21,23H,9-13,36-37H2,1-7H3/b14-8+/t15?,16-,18?,19?,20?,21?,23?/m1/s1 |
| InChIKey | PZEAAJKSJVDZPJ-PSDOENOBSA-N |
| XLogP | 5.66 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|