C26H40N4O6S — CID 90992218
(4S,7R,8S,9S,13R,14R,16S)-13-azido-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione (PubChem CID 90992218) has the molecular formula C26H40N4O6S and a molecular weight of 536.70 g/mol. Its IUPAC name is (4S,7R,8S,9S,13R,14R,16S)-13-azido-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13R,14R,16S)-13-azido-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 90992218 |
| Molecular Formula | C26H40N4O6S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (4S,7R,8S,9S,13R,14R,16S)-13-azido-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1C[C@@H](O)[C@H](N=[N+]=[N-])CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H40N4O6S/c1-14-8-7-9-19(29-30-27)20(31)11-21(15(2)10-18-13-37-17(4)28-18)36-23(33)12-22(32)26(5,6)25(35)16(3)24(14)34/h10,13-14,16,19-22,24,31-32,34H,7-9,11-12H2,1-6H3/t14-,16+,19+,20+,21-,22-,24-/m0/s1 |
| InChIKey | FSUDOYJFIRRYPU-YKGHFLNASA-N |
| XLogP | 4.36 |
| TPSA | 165.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|