C32H54N2O4SSi — CID 68890939
(4S,7R,8S,9S,13E)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 68890939) has the molecular formula C32H54N2O4SSi and a molecular weight of 590.95 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 68890939 |
| Molecular Formula | C32H54N2O4SSi |
| Molecular Weight | 590.95 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | (4S,7R,8S,9S,13E)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1C/C=C/CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)N1 |
| InChI | InChI=1S/C32H54N2O4SSi/c1-21-16-14-12-13-15-17-26(22(2)18-25-20-39-24(4)33-25)34-28(35)19-27(38-40(10,11)31(5,6)7)32(8,9)30(37)23(3)29(21)36/h13,15,18,20-21,23,26-27,29,36H,12,14,16-17,19H2,1-11H3,(H,34,35)/b15-13+,22-18+/t21-,23+,26?,27-,29-/m0/s1 |
| InChIKey | XVQJRBKNSFBQEG-KWLBJOLKSA-N |
| XLogP | 7.48 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.95 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|