C37H63NO5SSi2 — CID 10865357
(4S,7R,8S,9S,13E,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 10865357) has the molecular formula C37H63NO5SSi2 and a molecular weight of 690.15 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 10865357 |
| Molecular Formula | C37H63NO5SSi2 |
| Molecular Weight | 690.15 g/mol |
| Exact Mass | 689.40 |
| IUPAC Name | (4S,7R,8S,9S,13E,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9-tetramethyl-16-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | Cc1nc(C#C[C@@H]2C/C=C/CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O2)cs1 |
| InChI | InChI=1S/C37H63NO5SSi2/c1-26-20-18-16-17-19-21-30(23-22-29-25-44-28(3)38-29)41-32(39)24-31(42-45(12,13)35(4,5)6)37(10,11)34(40)27(2)33(26)43-46(14,15)36(7,8)9/h17,19,25-27,30-31,33H,16,18,20-21,24H2,1-15H3/b19-17+/t26-,27+,30-,31-,33-/m0/s1 |
| InChIKey | FNLBNHCIFZFKPB-ZMRNCYDOSA-N |
| XLogP | 9.88 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.15 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|