C21H34O4 — CID 142177230
(11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142177230) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142177230 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\C(C)COC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)C\C=C\1 |
| InChI | InChI=1S/C21H34O4/c1-14-8-7-9-15(2)11-17(4)20(24)21(5,6)18(22)12-19(23)25-13-16(3)10-14/h7-8,10,15-18,22H,9,11-13H2,1-6H3/b8-7+,14-10+ |
| InChIKey | GPLBHZHZNDQYDD-ACLLVWJRSA-N |
| XLogP | 4.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |