C28H42N2O4S — CID 91385343
(4S,7R,8S,9S,16S)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 91385343) has the molecular formula C28H42N2O4S and a molecular weight of 502.72 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 91385343 |
| Molecular Formula | C28H42N2O4S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=CC[C@@H](C(C)=Cc2csc(C)n2)N(C)C(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CC=C1 |
| InChI | InChI=1S/C28H42N2O4S/c1-17-10-9-11-18(2)26(33)20(4)27(34)28(6,7)24(31)15-25(32)30(8)23(13-12-17)19(3)14-22-16-35-21(5)29-22/h9-10,12,14,16,18,20,23-24,26,31,33H,11,13,15H2,1-8H3/t18-,20+,23-,24-,26-/m0/s1 |
| InChIKey | JAXAKKVOIYOPSU-ZPKBZZNZSA-N |
| XLogP | 4.96 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |