C30H41Cl3N2O6S — CID 91276723
[(4S,7R,8S,9S)-4-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-azacyclohexadeca-11,13-dien-8-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 91276723) has the molecular formula C30H41Cl3N2O6S and a molecular weight of 664.09 g/mol. Its IUPAC name is [(4S,7R,8S,9S)-4-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-azacyclohexadeca-11,13-dien-8-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(4S,7R,8S,9S)-4-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-azacyclohexadeca-11,13-dien-8-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 91276723 |
| Molecular Formula | C30H41Cl3N2O6S |
| Molecular Weight | 664.09 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | [(4S,7R,8S,9S)-4-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,6-dioxo-1-azacyclohexadeca-11,13-dien-8-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | CC1=CCC(C(C)=Cc2csc(C)n2)NC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)CC=C1 |
| InChI | InChI=1S/C30H41Cl3N2O6S/c1-17-9-8-10-18(2)26(41-28(39)40-16-30(31,32)33)20(4)27(38)29(6,7)24(36)14-25(37)35-23(12-11-17)19(3)13-22-15-42-21(5)34-22/h8-9,11,13,15,18,20,23-24,26,36H,10,12,14,16H2,1-7H3,(H,35,37)/t18-,20+,23?,24-,26-/m0/s1 |
| InChIKey | ZULBYYGPGHRTBT-POXXOAJUSA-N |
| XLogP | 7.15 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.09 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|