C28H42N2O5S — CID 142694666
(11Z)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-11-ene-2,6,10-trione (PubChem CID 142694666) has the molecular formula C28H42N2O5S and a molecular weight of 518.72 g/mol. Its IUPAC name is (11Z)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-11-ene-2,6,10-trione.
| Compound Name | (11Z)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-11-ene-2,6,10-trione |
|---|---|
| PubChem CID | 142694666 |
| Molecular Formula | C28H42N2O5S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | (11Z)-4,8-dihydroxy-1,5,5,7,9,13-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-11-ene-2,6,10-trione |
| SMILES | CC(=Cc1csc(C)n1)C1CCC(C)/C=C\C(=O)C(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)N1C |
| InChI | InChI=1S/C28H42N2O5S/c1-16-9-11-22(17(2)13-21-15-36-20(5)29-21)30(8)25(33)14-24(32)28(6,7)27(35)19(4)26(34)18(3)23(31)12-10-16/h10,12-13,15-16,18-19,22,24,26,32,34H,9,11,14H2,1-8H3/b12-10-,17-13? |
| InChIKey | LIIZOMGYJGLWLT-XQOSEKEISA-N |
| XLogP | 4.22 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |