C27H42N2O4S — CID 90906947
(4S,7S,8R,9R)-4,8-dihydroxy-1,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 90906947) has the molecular formula C27H42N2O4S and a molecular weight of 490.71 g/mol. Its IUPAC name is (4S,7S,8R,9R)-4,8-dihydroxy-1,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7S,8R,9R)-4,8-dihydroxy-1,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 90906947 |
| Molecular Formula | C27H42N2O4S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (4S,7S,8R,9R)-4,8-dihydroxy-1,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)C1CC=CCCC[C@@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1C |
| InChI | InChI=1S/C27H42N2O4S/c1-17-12-10-8-9-11-13-22(18(2)14-21-16-34-20(4)28-21)29(7)24(31)15-23(30)27(5,6)26(33)19(3)25(17)32/h9,11,14,16-17,19,22-23,25,30,32H,8,10,12-13,15H2,1-7H3/t17-,19+,22?,23+,25-/m1/s1 |
| InChIKey | VPCFDMBLLWLTTI-ZMKIAYQWSA-N |
| XLogP | 4.79 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|