C20H35NO3 — CID 142247820
(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 142247820) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142247820 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1CCC/C=C\[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H35NO3/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14/h8,10,14-17,22H,6-7,9,11-13H2,1-5H3,(H,21,23)/b10-8-/t14?,15-,16?,17?/m0/s1 |
| InChIKey | ZWCSUVIRVFIVAZ-NTHIJHEJSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|