C20H33NO3 — CID 142177217
(11E,13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142177217) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is (11E,13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (11E,13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142177217 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (11E,13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\CCNC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)C\C=C\1 |
| InChI | InChI=1S/C20H33NO3/c1-14-8-6-9-15(2)12-16(3)19(24)20(4,5)17(22)13-18(23)21-11-7-10-14/h6,8,10,15-17,22H,7,9,11-13H2,1-5H3,(H,21,23)/b8-6+,14-10+ |
| InChIKey | LDCQSAQQYKTXOX-RCAAVWGTSA-N |
| XLogP | 3.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |