C21H37NO4 — CID 142247887
(8S,13Z,15S)-4,8-dihydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 142247887) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is (8S,13Z,15S)-4,8-dihydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (8S,13Z,15S)-4,8-dihydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142247887 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | (8S,13Z,15S)-4,8-dihydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](O)C(C)CCC1 |
| InChI | InChI=1S/C21H37NO4/c1-13-8-7-9-15(3)19(25)16(4)20(26)21(5,6)17(23)11-18(24)22-12-14(2)10-13/h10,14-17,19,23,25H,7-9,11-12H2,1-6H3,(H,22,24)/b13-10-/t14-,15?,16?,17?,19-/m0/s1 |
| InChIKey | SXFSHSRJKDUEIY-KZLFZGEGSA-N |
| XLogP | 2.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|