C19H29NO3 — CID 142177257
(8Z,10E)-2-hydroxy-1,9,13,15-tetramethyl-5-azabicyclo[12.2.0]hexadeca-8,10-diene-4,16-dione (PubChem CID 142177257) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (8Z,10E)-2-hydroxy-1,9,13,15-tetramethyl-5-azabicyclo[12.2.0]hexadeca-8,10-diene-4,16-dione.
| Compound Name | (8Z,10E)-2-hydroxy-1,9,13,15-tetramethyl-5-azabicyclo[12.2.0]hexadeca-8,10-diene-4,16-dione |
|---|---|
| PubChem CID | 142177257 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (8Z,10E)-2-hydroxy-1,9,13,15-tetramethyl-5-azabicyclo[12.2.0]hexadeca-8,10-diene-4,16-dione |
| SMILES | CC1=C/CCNC(=O)CC(O)C2(C)C(=O)C(C)C2C(C)C\C=C\1 |
| InChI | InChI=1S/C19H29NO3/c1-12-7-5-9-13(2)17-14(3)18(23)19(17,4)15(21)11-16(22)20-10-6-8-12/h5,7-8,13-15,17,21H,6,9-11H2,1-4H3,(H,20,22)/b7-5+,12-8- |
| InChIKey | FCEYZBVZHIIKMM-VRGHMPIDSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |