C19H33NO3 — CID 142247839
(13Z,15S)-4-hydroxy-5,7,9,15-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 142247839) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is (13Z,15S)-4-hydroxy-5,7,9,15-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z,15S)-4-hydroxy-5,7,9,15-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142247839 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | (13Z,15S)-4-hydroxy-5,7,9,15-tetramethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1CCC/C=C\[C@H](C)CNC(=O)CC(O)C(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C19H33NO3/c1-13-8-6-5-7-9-14(2)12-20-18(22)11-17(21)16(4)19(23)15(3)10-13/h7,9,13-17,21H,5-6,8,10-12H2,1-4H3,(H,20,22)/b9-7-/t13?,14-,15?,16?,17?/m0/s1 |
| InChIKey | KENUCOHMFICFHK-ZKZKLNKTSA-N |
| XLogP | 3.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|