C31H54N2O3 — CID 142247798
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]butan-2-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 142247798) has the molecular formula C31H54N2O3 and a molecular weight of 502.78 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]butan-2-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]butan-2-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142247798 |
| Molecular Formula | C31H54N2O3 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.41 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]butan-2-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)CCC1.C/C=C\C(=C\C)\N=C(/C)CC |
| InChI | InChI=1S/C21H37NO3.C10H17N/c1-14-8-7-9-15(2)11-17(4)20(25)21(5,6)18(23)12-19(24)22-13-16(3)10-14;1-5-8-10(7-3)11-9(4)6-2/h10,15-18,23H,7-9,11-13H2,1-6H3,(H,22,24);5,7-8H,6H2,1-4H3/b14-10-;8-5-,10-7-,11-9+/t15?,16-,17?,18?;/m0./s1 |
| InChIKey | VWCSDHWICHYOSQ-FXKRUSFMSA-N |
| XLogP | 7.21 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|