C36H64N2O3 — CID 142247801
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]-2-methyloctan-4-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 142247801) has the molecular formula C36H64N2O3 and a molecular weight of 572.92 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]-2-methyloctan-4-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]-2-methyloctan-4-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142247801 |
| Molecular Formula | C36H64N2O3 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.49 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]-2-methyloctan-4-imine;(13Z,15S)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)CCC1.C/C=C\C(=C\C)\N=C(/CCCC)CC(C)C |
| InChI | InChI=1S/C21H37NO3.C15H27N/c1-14-8-7-9-15(2)11-17(4)20(25)21(5,6)18(23)12-19(24)22-13-16(3)10-14;1-6-9-11-15(12-13(4)5)16-14(8-3)10-7-2/h10,15-18,23H,7-9,11-13H2,1-6H3,(H,22,24);7-8,10,13H,6,9,11-12H2,1-5H3/b14-10-;10-7-,14-8-,16-15+/t15?,16-,17?,18?;/m0./s1 |
| InChIKey | UOJVSQIPGAVAQT-KOKICNMWSA-N |
| XLogP | 9.02 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|